C21H15Cl4NO2S2 — CID 158357172
N-(3,5-dichlorophenyl)-4-[3-(3,4-dichlorophenyl)-2-sulfanylidenepropyl]benzenesulfonamide (PubChem CID 158357172) has the molecular formula C21H15Cl4NO2S2 and a molecular weight of 519.30 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-[3-(3,4-dichlorophenyl)-2-sulfanylidenepropyl]benzenesulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-[3-(3,4-dichlorophenyl)-2-sulfanylidenepropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 158357172 |
| Molecular Formula | C21H15Cl4NO2S2 |
| Molecular Weight | 519.30 g/mol |
| Exact Mass | 516.93 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-[3-(3,4-dichlorophenyl)-2-sulfanylidenepropyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)cc(Cl)c1)c1ccc(CC(=S)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H15Cl4NO2S2/c22-15-10-16(23)12-17(11-15)26-30(27,28)19-4-1-13(2-5-19)7-18(29)8-14-3-6-20(24)21(25)9-14/h1-6,9-12,26H,7-8H2 |
| InChIKey | GTAFCPSAQZWAGO-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.30 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|