C22H19Cl2NO2S2 — CID 159911665
N-(3,4-dichlorophenyl)-4-[3-(3-methylphenyl)-2-sulfanylidenepropyl]benzenesulfonamide (PubChem CID 159911665) has the molecular formula C22H19Cl2NO2S2 and a molecular weight of 464.44 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-[3-(3-methylphenyl)-2-sulfanylidenepropyl]benzenesulfonamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-[3-(3-methylphenyl)-2-sulfanylidenepropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 159911665 |
| Molecular Formula | C22H19Cl2NO2S2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-[3-(3-methylphenyl)-2-sulfanylidenepropyl]benzenesulfonamide |
| SMILES | Cc1cccc(CC(=S)Cc2ccc(S(=O)(=O)Nc3ccc(Cl)c(Cl)c3)cc2)c1 |
| InChI | InChI=1S/C22H19Cl2NO2S2/c1-15-3-2-4-17(11-15)13-19(28)12-16-5-8-20(9-6-16)29(26,27)25-18-7-10-21(23)22(24)14-18/h2-11,14,25H,12-13H2,1H3 |
| InChIKey | NXGHMCGLMMAFKR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|