C22H16Cl2F3NO2S2 — CID 152959886
N-(3,5-dichlorophenyl)-4-[2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]propyl]benzenesulfonamide (PubChem CID 152959886) has the molecular formula C22H16Cl2F3NO2S2 and a molecular weight of 518.41 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-[2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]propyl]benzenesulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-[2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 152959886 |
| Molecular Formula | C22H16Cl2F3NO2S2 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 517.00 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-[2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]propyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)cc(Cl)c1)c1ccc(CC(=S)Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H16Cl2F3NO2S2/c23-17-11-18(24)13-19(12-17)28-32(29,30)21-6-4-14(5-7-21)9-20(31)10-15-2-1-3-16(8-15)22(25,26)27/h1-8,11-13,28H,9-10H2 |
| InChIKey | UQIUQOKAEBGKRK-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|