C24H19NO6S — CID 5011589
ethyl 2-[4-[(9,10-dioxoanthracen-2-yl)sulfonylamino]phenyl]acetate (PubChem CID 5011589) has the molecular formula C24H19NO6S and a molecular weight of 449.48 g/mol. Its IUPAC name is ethyl 2-[4-[(9,10-dioxoanthracen-2-yl)sulfonylamino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[(9,10-dioxoanthracen-2-yl)sulfonylamino]phenyl]acetate |
|---|---|
| PubChem CID | 5011589 |
| Molecular Formula | C24H19NO6S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | ethyl 2-[4-[(9,10-dioxoanthracen-2-yl)sulfonylamino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NS(=O)(=O)c2ccc3c(c2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C24H19NO6S/c1-2-31-22(26)13-15-7-9-16(10-8-15)25-32(29,30)17-11-12-20-21(14-17)24(28)19-6-4-3-5-18(19)23(20)27/h3-12,14,25H,2,13H2,1H3 |
| InChIKey | UQDUENHRUIWQRV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|