C18H20BrNO4S — CID 4984042
ethyl 2-[4-[(4-bromo-2-ethylphenyl)sulfonylamino]phenyl]acetate (PubChem CID 4984042) has the molecular formula C18H20BrNO4S and a molecular weight of 426.33 g/mol. Its IUPAC name is ethyl 2-[4-[(4-bromo-2-ethylphenyl)sulfonylamino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[(4-bromo-2-ethylphenyl)sulfonylamino]phenyl]acetate |
|---|---|
| PubChem CID | 4984042 |
| Molecular Formula | C18H20BrNO4S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | ethyl 2-[4-[(4-bromo-2-ethylphenyl)sulfonylamino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NS(=O)(=O)c2ccc(Br)cc2CC)cc1 |
| InChI | InChI=1S/C18H20BrNO4S/c1-3-14-12-15(19)7-10-17(14)25(22,23)20-16-8-5-13(6-9-16)11-18(21)24-4-2/h5-10,12,20H,3-4,11H2,1-2H3 |
| InChIKey | CYRDJQLRFJBVMU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |