C16H16BrNO5S — CID 55353268
methyl 5-bromo-2-[(4-ethoxyphenyl)sulfamoyl]benzoate (PubChem CID 55353268) has the molecular formula C16H16BrNO5S and a molecular weight of 414.28 g/mol. Its IUPAC name is methyl 5-bromo-2-[(4-ethoxyphenyl)sulfamoyl]benzoate.
| Compound Name | methyl 5-bromo-2-[(4-ethoxyphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 55353268 |
| Molecular Formula | C16H16BrNO5S |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | methyl 5-bromo-2-[(4-ethoxyphenyl)sulfamoyl]benzoate |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(Br)cc2C(=O)OC)cc1 |
| InChI | InChI=1S/C16H16BrNO5S/c1-3-23-13-7-5-12(6-8-13)18-24(20,21)15-9-4-11(17)10-14(15)16(19)22-2/h4-10,18H,3H2,1-2H3 |
| InChIKey | OIBNRCRFZCFENF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |