C18H20BrNO4S — CID 112769236
methyl 5-bromo-2-[(2,6-diethylphenyl)sulfamoyl]benzoate (PubChem CID 112769236) has the molecular formula C18H20BrNO4S and a molecular weight of 426.33 g/mol. Its IUPAC name is methyl 5-bromo-2-[(2,6-diethylphenyl)sulfamoyl]benzoate.
| Compound Name | methyl 5-bromo-2-[(2,6-diethylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 112769236 |
| Molecular Formula | C18H20BrNO4S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | methyl 5-bromo-2-[(2,6-diethylphenyl)sulfamoyl]benzoate |
| SMILES | CCc1cccc(CC)c1NS(=O)(=O)c1ccc(Br)cc1C(=O)OC |
| InChI | InChI=1S/C18H20BrNO4S/c1-4-12-7-6-8-13(5-2)17(12)20-25(22,23)16-10-9-14(19)11-15(16)18(21)24-3/h6-11,20H,4-5H2,1-3H3 |
| InChIKey | AOUIMMWQUFUMLW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |