C18H15BrN2O5S — CID 25334935
methyl 5-bromo-2-[[4-(2-methyl-1,3-oxazol-5-yl)phenyl]sulfamoyl]benzoate (PubChem CID 25334935) has the molecular formula C18H15BrN2O5S and a molecular weight of 451.30 g/mol. Its IUPAC name is methyl 5-bromo-2-[[4-(2-methyl-1,3-oxazol-5-yl)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 5-bromo-2-[[4-(2-methyl-1,3-oxazol-5-yl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25334935 |
| Molecular Formula | C18H15BrN2O5S |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | methyl 5-bromo-2-[[4-(2-methyl-1,3-oxazol-5-yl)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1cc(Br)ccc1S(=O)(=O)Nc1ccc(-c2cnc(C)o2)cc1 |
| InChI | InChI=1S/C18H15BrN2O5S/c1-11-20-10-16(26-11)12-3-6-14(7-4-12)21-27(23,24)17-8-5-13(19)9-15(17)18(22)25-2/h3-10,21H,1-2H3 |
| InChIKey | WNZMKFVWHFPOJF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |