C25H27BrN2O5S — CID 17350003
5-bromo-2-butoxy-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 17350003) has the molecular formula C25H27BrN2O5S and a molecular weight of 547.47 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 17350003 |
| Molecular Formula | C25H27BrN2O5S |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 5-bromo-2-butoxy-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C25H27BrN2O5S/c1-3-5-16-33-24-15-6-18(26)17-23(24)25(29)27-19-9-13-22(14-10-19)34(30,31)28-20-7-11-21(12-8-20)32-4-2/h6-15,17,28H,3-5,16H2,1-2H3,(H,27,29) |
| InChIKey | ULGXOIFTJUUHIW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|