C19H23BrN2O4S — CID 17350006
5-bromo-2-butoxy-N-[4-(dimethylsulfamoyl)phenyl]benzamide (PubChem CID 17350006) has the molecular formula C19H23BrN2O4S and a molecular weight of 455.37 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[4-(dimethylsulfamoyl)phenyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[4-(dimethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17350006 |
| Molecular Formula | C19H23BrN2O4S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 5-bromo-2-butoxy-N-[4-(dimethylsulfamoyl)phenyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C19H23BrN2O4S/c1-4-5-12-26-18-11-6-14(20)13-17(18)19(23)21-15-7-9-16(10-8-15)27(24,25)22(2)3/h6-11,13H,4-5,12H2,1-3H3,(H,21,23) |
| InChIKey | KBDHIYIRSGNROJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|