C25H35BrN2O4S — CID 17343418
5-bromo-N-[4-(dipropylsulfamoyl)phenyl]-2-hexoxybenzamide (PubChem CID 17343418) has the molecular formula C25H35BrN2O4S and a molecular weight of 539.54 g/mol. Its IUPAC name is 5-bromo-N-[4-(dipropylsulfamoyl)phenyl]-2-hexoxybenzamide.
| Compound Name | 5-bromo-N-[4-(dipropylsulfamoyl)phenyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17343418 |
| Molecular Formula | C25H35BrN2O4S |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 5-bromo-N-[4-(dipropylsulfamoyl)phenyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)N(CCC)CCC)cc1 |
| InChI | InChI=1S/C25H35BrN2O4S/c1-4-7-8-9-18-32-24-15-10-20(26)19-23(24)25(29)27-21-11-13-22(14-12-21)33(30,31)28(16-5-2)17-6-3/h10-15,19H,4-9,16-18H2,1-3H3,(H,27,29) |
| InChIKey | KPPOIHABRXTIMI-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|