C26H35BrN2O3 — CID 17196231
5-bromo-N-[4-(dipropylcarbamoyl)phenyl]-2-hexoxybenzamide (PubChem CID 17196231) has the molecular formula C26H35BrN2O3 and a molecular weight of 503.48 g/mol. Its IUPAC name is 5-bromo-N-[4-(dipropylcarbamoyl)phenyl]-2-hexoxybenzamide.
| Compound Name | 5-bromo-N-[4-(dipropylcarbamoyl)phenyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17196231 |
| Molecular Formula | C26H35BrN2O3 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 5-bromo-N-[4-(dipropylcarbamoyl)phenyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)Nc1ccc(C(=O)N(CCC)CCC)cc1 |
| InChI | InChI=1S/C26H35BrN2O3/c1-4-7-8-9-18-32-24-15-12-21(27)19-23(24)25(30)28-22-13-10-20(11-14-22)26(31)29(16-5-2)17-6-3/h10-15,19H,4-9,16-18H2,1-3H3,(H,28,30) |
| InChIKey | ZBSPSWZKRSTXQV-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|