C24H31BrN2O3 — CID 17201327
5-bromo-N-[4-(butan-2-ylcarbamoyl)phenyl]-2-hexoxybenzamide (PubChem CID 17201327) has the molecular formula C24H31BrN2O3 and a molecular weight of 475.43 g/mol. Its IUPAC name is 5-bromo-N-[4-(butan-2-ylcarbamoyl)phenyl]-2-hexoxybenzamide.
| Compound Name | 5-bromo-N-[4-(butan-2-ylcarbamoyl)phenyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17201327 |
| Molecular Formula | C24H31BrN2O3 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 5-bromo-N-[4-(butan-2-ylcarbamoyl)phenyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)Nc1ccc(C(=O)NC(C)CC)cc1 |
| InChI | InChI=1S/C24H31BrN2O3/c1-4-6-7-8-15-30-22-14-11-19(25)16-21(22)24(29)27-20-12-9-18(10-13-20)23(28)26-17(3)5-2/h9-14,16-17H,4-8,15H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | VYAJPCQRSXOMOX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|