C25H24BrN3O4 — CID 17350275
N-[4-[[(5-bromo-2-butoxybenzoyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 17350275) has the molecular formula C25H24BrN3O4 and a molecular weight of 510.39 g/mol. Its IUPAC name is N-[4-[[(5-bromo-2-butoxybenzoyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | N-[4-[[(5-bromo-2-butoxybenzoyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 17350275 |
| Molecular Formula | C25H24BrN3O4 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | N-[4-[[(5-bromo-2-butoxybenzoyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NNC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24BrN3O4/c1-2-3-15-33-22-14-11-19(26)16-21(22)25(32)29-28-24(31)18-9-12-20(13-10-18)27-23(30)17-7-5-4-6-8-17/h4-14,16H,2-3,15H2,1H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | JXNVYPPWODUNJQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|