C24H30BrN3O4 — CID 17350925
N-[4-[[[5-bromo-2-(3-methylbutoxy)benzoyl]amino]carbamoyl]phenyl]pentanamide (PubChem CID 17350925) has the molecular formula C24H30BrN3O4 and a molecular weight of 504.43 g/mol. Its IUPAC name is N-[4-[[[5-bromo-2-(3-methylbutoxy)benzoyl]amino]carbamoyl]phenyl]pentanamide.
| Compound Name | N-[4-[[[5-bromo-2-(3-methylbutoxy)benzoyl]amino]carbamoyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 17350925 |
| Molecular Formula | C24H30BrN3O4 |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N-[4-[[[5-bromo-2-(3-methylbutoxy)benzoyl]amino]carbamoyl]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(C(=O)NNC(=O)c2cc(Br)ccc2OCCC(C)C)cc1 |
| InChI | InChI=1S/C24H30BrN3O4/c1-4-5-6-22(29)26-19-10-7-17(8-11-19)23(30)27-28-24(31)20-15-18(25)9-12-21(20)32-14-13-16(2)3/h7-12,15-16H,4-6,13-14H2,1-3H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | UFKIGELQLYGVDP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|