C22H26BrN3O5 — CID 17357411
N-[4-[[[5-bromo-2-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]-3-methylbutanamide (PubChem CID 17357411) has the molecular formula C22H26BrN3O5 and a molecular weight of 492.37 g/mol. Its IUPAC name is N-[4-[[[5-bromo-2-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[[[5-bromo-2-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 17357411 |
| Molecular Formula | C22H26BrN3O5 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[4-[[[5-bromo-2-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]-3-methylbutanamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NNC(=O)c1ccc(NC(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C22H26BrN3O5/c1-14(2)12-20(27)24-17-7-4-15(5-8-17)21(28)25-26-22(29)18-13-16(23)6-9-19(18)31-11-10-30-3/h4-9,13-14H,10-12H2,1-3H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | ILOAEKTXJKMDPD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|