C25H24BrN3O3S — CID 17350556
5-bromo-2-butoxy-N-[[(4-phenylbenzoyl)amino]carbamothioyl]benzamide (PubChem CID 17350556) has the molecular formula C25H24BrN3O3S and a molecular weight of 526.46 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[[(4-phenylbenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[[(4-phenylbenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17350556 |
| Molecular Formula | C25H24BrN3O3S |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | 5-bromo-2-butoxy-N-[[(4-phenylbenzoyl)amino]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NC(=S)NNC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24BrN3O3S/c1-2-3-15-32-22-14-13-20(26)16-21(22)24(31)27-25(33)29-28-23(30)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-14,16H,2-3,15H2,1H3,(H,28,30)(H2,27,29,31,33) |
| InChIKey | ZPDPIGSCHOHVDW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|