C26H29BrN2O5S — CID 17343317
5-bromo-2-hexoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 17343317) has the molecular formula C26H29BrN2O5S and a molecular weight of 561.50 g/mol. Its IUPAC name is 5-bromo-2-hexoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 5-bromo-2-hexoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 17343317 |
| Molecular Formula | C26H29BrN2O5S |
| Molecular Weight | 561.50 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 5-bromo-2-hexoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H29BrN2O5S/c1-3-4-5-6-17-34-25-16-7-19(27)18-24(25)26(30)28-20-10-14-23(15-11-20)35(31,32)29-21-8-12-22(33-2)13-9-21/h7-16,18,29H,3-6,17H2,1-2H3,(H,28,30) |
| InChIKey | JWGIHABMAHRLEW-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.50 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|