C20H23BrN2O8S2 — CID 19032738
ethyl 2-[4-[[2-[(4-bromophenyl)sulfonylamino]-3-methylsulfonyloxypropanoyl]amino]phenyl]acetate (PubChem CID 19032738) has the molecular formula C20H23BrN2O8S2 and a molecular weight of 563.45 g/mol. Its IUPAC name is ethyl 2-[4-[[2-[(4-bromophenyl)sulfonylamino]-3-methylsulfonyloxypropanoyl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[2-[(4-bromophenyl)sulfonylamino]-3-methylsulfonyloxypropanoyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 19032738 |
| Molecular Formula | C20H23BrN2O8S2 |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 562.01 |
| IUPAC Name | ethyl 2-[4-[[2-[(4-bromophenyl)sulfonylamino]-3-methylsulfonyloxypropanoyl]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)C(COS(C)(=O)=O)NS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H23BrN2O8S2/c1-3-30-19(24)12-14-4-8-16(9-5-14)22-20(25)18(13-31-32(2,26)27)23-33(28,29)17-10-6-15(21)7-11-17/h4-11,18,23H,3,12-13H2,1-2H3,(H,22,25) |
| InChIKey | XBPHULCBOULRCS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|