C20H23ClN2O5S — CID 67706856
ethyl 2-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]butanoyl]amino]phenyl]acetate (PubChem CID 67706856) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is ethyl 2-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]butanoyl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]butanoyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 67706856 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | ethyl 2-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]butanoyl]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)[C@H](CC)NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H23ClN2O5S/c1-3-18(23-29(26,27)17-11-7-15(21)8-12-17)20(25)22-16-9-5-14(6-10-16)13-19(24)28-4-2/h5-12,18,23H,3-4,13H2,1-2H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | KCRXRVHGFYHTNE-SFHVURJKSA-N |
| XLogP | 3.14 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |