C20H23ClN2O5S — CID 54410070
2-[4-[[2-[(4-chlorophenyl)sulfonylamino]-4-methylpentanoyl]amino]phenyl]acetic acid (PubChem CID 54410070) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is 2-[4-[[2-[(4-chlorophenyl)sulfonylamino]-4-methylpentanoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[2-[(4-chlorophenyl)sulfonylamino]-4-methylpentanoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 54410070 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2-[4-[[2-[(4-chlorophenyl)sulfonylamino]-4-methylpentanoyl]amino]phenyl]acetic acid |
| SMILES | CC(C)CC(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)Nc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C20H23ClN2O5S/c1-13(2)11-18(23-29(27,28)17-9-5-15(21)6-10-17)20(26)22-16-7-3-14(4-8-16)12-19(24)25/h3-10,13,18,23H,11-12H2,1-2H3,(H,22,26)(H,24,25) |
| InChIKey | VTMKICQXTRJOST-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |