C19H21ClN2O4S2 — CID 54076027
2-[4-[2-[(4-chlorophenyl)sulfonylamino]pentanethioylamino]phenyl]acetic acid (PubChem CID 54076027) has the molecular formula C19H21ClN2O4S2 and a molecular weight of 440.97 g/mol. Its IUPAC name is 2-[4-[2-[(4-chlorophenyl)sulfonylamino]pentanethioylamino]phenyl]acetic acid.
| Compound Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]pentanethioylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 54076027 |
| Molecular Formula | C19H21ClN2O4S2 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]pentanethioylamino]phenyl]acetic acid |
| SMILES | CCCC(NS(=O)(=O)c1ccc(Cl)cc1)C(=S)Nc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C19H21ClN2O4S2/c1-2-3-17(22-28(25,26)16-10-6-14(20)7-11-16)19(27)21-15-8-4-13(5-9-15)12-18(23)24/h4-11,17,22H,2-3,12H2,1H3,(H,21,27)(H,23,24) |
| InChIKey | MJSPQWJTOUNHGB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|