C20H23ClN2O4S2 — CID 19032903
ethyl 3-[2-[(4-chlorophenyl)sulfonylamino]pentanethioylamino]benzoate (PubChem CID 19032903) has the molecular formula C20H23ClN2O4S2 and a molecular weight of 455.00 g/mol. Its IUPAC name is ethyl 3-[2-[(4-chlorophenyl)sulfonylamino]pentanethioylamino]benzoate.
| Compound Name | ethyl 3-[2-[(4-chlorophenyl)sulfonylamino]pentanethioylamino]benzoate |
|---|---|
| PubChem CID | 19032903 |
| Molecular Formula | C20H23ClN2O4S2 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | ethyl 3-[2-[(4-chlorophenyl)sulfonylamino]pentanethioylamino]benzoate |
| SMILES | CCCC(NS(=O)(=O)c1ccc(Cl)cc1)C(=S)Nc1cccc(C(=O)OCC)c1 |
| InChI | InChI=1S/C20H23ClN2O4S2/c1-3-6-18(23-29(25,26)17-11-9-15(21)10-12-17)19(28)22-16-8-5-7-14(13-16)20(24)27-4-2/h5,7-13,18,23H,3-4,6H2,1-2H3,(H,22,28) |
| InChIKey | DHUDRHWRALTRIM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|