C22H27ClN2O4S2 — CID 54316364
ethyl 2-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]hexanethioyl]amino]phenyl]acetate (PubChem CID 54316364) has the molecular formula C22H27ClN2O4S2 and a molecular weight of 483.06 g/mol. Its IUPAC name is ethyl 2-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]hexanethioyl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]hexanethioyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 54316364 |
| Molecular Formula | C22H27ClN2O4S2 |
| Molecular Weight | 483.06 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | ethyl 2-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]hexanethioyl]amino]phenyl]acetate |
| SMILES | CCCC[C@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=S)Nc1ccc(CC(=O)OCC)cc1 |
| InChI | InChI=1S/C22H27ClN2O4S2/c1-3-5-6-20(25-31(27,28)19-13-9-17(23)10-14-19)22(30)24-18-11-7-16(8-12-18)15-21(26)29-4-2/h7-14,20,25H,3-6,15H2,1-2H3,(H,24,30)/t20-/m0/s1 |
| InChIKey | SOLSJVBHQLGQCB-FQEVSTJZSA-N |
| XLogP | 4.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.06 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|