C21H25ClN2O4S2 — CID 54455700
methyl 3-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]pentanethioyl]amino]phenyl]propanoate (PubChem CID 54455700) has the molecular formula C21H25ClN2O4S2 and a molecular weight of 469.03 g/mol. Its IUPAC name is methyl 3-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]pentanethioyl]amino]phenyl]propanoate.
| Compound Name | methyl 3-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]pentanethioyl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 54455700 |
| Molecular Formula | C21H25ClN2O4S2 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | methyl 3-[4-[[(2S)-2-[(4-chlorophenyl)sulfonylamino]pentanethioyl]amino]phenyl]propanoate |
| SMILES | CCC[C@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=S)Nc1ccc(CCC(=O)OC)cc1 |
| InChI | InChI=1S/C21H25ClN2O4S2/c1-3-4-19(24-30(26,27)18-12-8-16(22)9-13-18)21(29)23-17-10-5-15(6-11-17)7-14-20(25)28-2/h5-6,8-13,19,24H,3-4,7,14H2,1-2H3,(H,23,29)/t19-/m0/s1 |
| InChIKey | WYALBIBSWSIANB-IBGZPJMESA-N |
| XLogP | 4.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|