C21H25ClN2O5S — CID 174348361
ethyl 4-[2-[(4-chlorophenyl)sulfonylamino]hexanoylamino]benzoate (PubChem CID 174348361) has the molecular formula C21H25ClN2O5S and a molecular weight of 452.96 g/mol. Its IUPAC name is ethyl 4-[2-[(4-chlorophenyl)sulfonylamino]hexanoylamino]benzoate.
| Compound Name | ethyl 4-[2-[(4-chlorophenyl)sulfonylamino]hexanoylamino]benzoate |
|---|---|
| PubChem CID | 174348361 |
| Molecular Formula | C21H25ClN2O5S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | ethyl 4-[2-[(4-chlorophenyl)sulfonylamino]hexanoylamino]benzoate |
| SMILES | CCCCC(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)Nc1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C21H25ClN2O5S/c1-3-5-6-19(24-30(27,28)18-13-9-16(22)10-14-18)20(25)23-17-11-7-15(8-12-17)21(26)29-4-2/h7-14,19,24H,3-6H2,1-2H3,(H,23,25) |
| InChIKey | IMRNAGLSPZVRDQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |