C22H18Cl2N2O5S — CID 22646291
ethyl 3-[[5-chloro-2-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]benzoate (PubChem CID 22646291) has the molecular formula C22H18Cl2N2O5S and a molecular weight of 493.37 g/mol. Its IUPAC name is ethyl 3-[[5-chloro-2-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]benzoate.
| Compound Name | ethyl 3-[[5-chloro-2-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 22646291 |
| Molecular Formula | C22H18Cl2N2O5S |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | ethyl 3-[[5-chloro-2-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)c2cc(Cl)ccc2NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H18Cl2N2O5S/c1-2-31-22(28)14-4-3-5-17(12-14)25-21(27)19-13-16(24)8-11-20(19)26-32(29,30)18-9-6-15(23)7-10-18/h3-13,26H,2H2,1H3,(H,25,27) |
| InChIKey | RSYHROIOACOLQK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |