C20H18ClN5O4S2 — CID 163322765
ethyl 3-[[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]carbamothioylamino]benzoate (PubChem CID 163322765) has the molecular formula C20H18ClN5O4S2 and a molecular weight of 491.98 g/mol. Its IUPAC name is ethyl 3-[[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 3-[[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 163322765 |
| Molecular Formula | C20H18ClN5O4S2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | ethyl 3-[[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)nn3)cc2)c1 |
| InChI | InChI=1S/C20H18ClN5O4S2/c1-2-30-19(27)13-4-3-5-15(12-13)23-20(31)22-14-6-8-16(9-7-14)32(28,29)26-18-11-10-17(21)24-25-18/h3-12H,2H2,1H3,(H,25,26)(H2,22,23,31) |
| InChIKey | GXRYIFCZSOANCD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|