C11H13N3O4S2 — CID 108782501
ethyl 1-methyl-5-(thiophen-2-ylsulfonylamino)pyrazole-4-carboxylate (PubChem CID 108782501) has the molecular formula C11H13N3O4S2 and a molecular weight of 315.38 g/mol. Its IUPAC name is ethyl 1-methyl-5-(thiophen-2-ylsulfonylamino)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-(thiophen-2-ylsulfonylamino)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108782501 |
| Molecular Formula | C11H13N3O4S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | ethyl 1-methyl-5-(thiophen-2-ylsulfonylamino)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C11H13N3O4S2/c1-3-18-11(15)8-7-12-14(2)10(8)13-20(16,17)9-5-4-6-19-9/h4-7,13H,3H2,1-2H3 |
| InChIKey | KEEVZMRNOSQIIT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |