C23H22N4O6S — CID 108782504
ethyl 5-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-1-methylpyrazole-4-carboxylate (PubChem CID 108782504) has the molecular formula C23H22N4O6S and a molecular weight of 482.52 g/mol. Its IUPAC name is ethyl 5-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108782504 |
| Molecular Formula | C23H22N4O6S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | ethyl 5-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NS(=O)(=O)c1ccc(CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H22N4O6S/c1-3-33-23(30)19-14-24-26(2)20(19)25-34(31,32)16-10-8-15(9-11-16)12-13-27-21(28)17-6-4-5-7-18(17)22(27)29/h4-11,14,25H,3,12-13H2,1-2H3 |
| InChIKey | SODXTAFAWJUEPC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|