C24H21N3O7S — CID 108782846
4-acetyl-2-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-5-methylfuran-3-carboxamide (PubChem CID 108782846) has the molecular formula C24H21N3O7S and a molecular weight of 495.51 g/mol. Its IUPAC name is 4-acetyl-2-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-5-methylfuran-3-carboxamide.
| Compound Name | 4-acetyl-2-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-5-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 108782846 |
| Molecular Formula | C24H21N3O7S |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 4-acetyl-2-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]sulfonylamino]-5-methylfuran-3-carboxamide |
| SMILES | CC(=O)c1c(C)oc(NS(=O)(=O)c2ccc(CCN3C(=O)c4ccccc4C3=O)cc2)c1C(N)=O |
| InChI | InChI=1S/C24H21N3O7S/c1-13(28)19-14(2)34-22(20(19)21(25)29)26-35(32,33)16-9-7-15(8-10-16)11-12-27-23(30)17-5-3-4-6-18(17)24(27)31/h3-10,26H,11-12H2,1-2H3,(H2,25,29) |
| InChIKey | WORFMDXLVAWKDN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 156.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|