C22H18ClN3O4S — CID 20914152
N-(4-chloro-2-methylphenyl)-4-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]benzenesulfonamide (PubChem CID 20914152) has the molecular formula C22H18ClN3O4S and a molecular weight of 455.92 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-4-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]benzenesulfonamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-4-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20914152 |
| Molecular Formula | C22H18ClN3O4S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-4-[2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(Cl)ccc1NS(=O)(=O)c1ccc(CCN2C(=O)c3cccnc3C2=O)cc1 |
| InChI | InChI=1S/C22H18ClN3O4S/c1-14-13-16(23)6-9-19(14)25-31(29,30)17-7-4-15(5-8-17)10-12-26-21(27)18-3-2-11-24-20(18)22(26)28/h2-9,11,13,25H,10,12H2,1H3 |
| InChIKey | ZSLFRJSENCMSAT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|