C21H16ClN3O5S — CID 20914323
N-(3-chloro-4-methoxyphenyl)-4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]benzenesulfonamide (PubChem CID 20914323) has the molecular formula C21H16ClN3O5S and a molecular weight of 457.90 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]benzenesulfonamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20914323 |
| Molecular Formula | C21H16ClN3O5S |
| Molecular Weight | 457.90 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(CN3C(=O)c4cccnc4C3=O)cc2)cc1Cl |
| InChI | InChI=1S/C21H16ClN3O5S/c1-30-18-9-6-14(11-17(18)22)24-31(28,29)15-7-4-13(5-8-15)12-25-20(26)16-3-2-10-23-19(16)21(25)27/h2-11,24H,12H2,1H3 |
| InChIKey | DWHDDKORDDGHPL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.90 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|