C21H16FN3O5S — CID 20970003
5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(4-fluorophenyl)-2-methoxybenzenesulfonamide (PubChem CID 20970003) has the molecular formula C21H16FN3O5S and a molecular weight of 441.44 g/mol. Its IUPAC name is 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(4-fluorophenyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(4-fluorophenyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 20970003 |
| Molecular Formula | C21H16FN3O5S |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(4-fluorophenyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(CN2C(=O)c3cccnc3C2=O)cc1S(=O)(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H16FN3O5S/c1-30-17-9-4-13(12-25-20(26)16-3-2-10-23-19(16)21(25)27)11-18(17)31(28,29)24-15-7-5-14(22)6-8-15/h2-11,24H,12H2,1H3 |
| InChIKey | NAEMUHLTQULCDH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|