C21H17N3O5S — CID 20914238
4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(3-methoxyphenyl)benzenesulfonamide (PubChem CID 20914238) has the molecular formula C21H17N3O5S and a molecular weight of 423.45 g/mol. Its IUPAC name is 4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(3-methoxyphenyl)benzenesulfonamide.
| Compound Name | 4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(3-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 20914238 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(3-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2ccc(CN3C(=O)c4cccnc4C3=O)cc2)c1 |
| InChI | InChI=1S/C21H17N3O5S/c1-29-16-5-2-4-15(12-16)23-30(27,28)17-9-7-14(8-10-17)13-24-20(25)18-6-3-11-22-19(18)21(24)26/h2-12,23H,13H2,1H3 |
| InChIKey | SNKJKPKETVVRLR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|