C23H21N3O7S — CID 20923111
N-(3,5-dimethoxyphenyl)-5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-2-methoxybenzenesulfonamide (PubChem CID 20923111) has the molecular formula C23H21N3O7S and a molecular weight of 483.50 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-2-methoxybenzenesulfonamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 20923111 |
| Molecular Formula | C23H21N3O7S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cc(CN3C(=O)c4cccnc4C3=O)ccc2OC)cc(OC)c1 |
| InChI | InChI=1S/C23H21N3O7S/c1-31-16-10-15(11-17(12-16)32-2)25-34(29,30)20-9-14(6-7-19(20)33-3)13-26-22(27)18-5-4-8-24-21(18)23(26)28/h4-12,25H,13H2,1-3H3 |
| InChIKey | MBTISRBPCGLXGJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|