C21H16ClN3O4S — CID 20914244
N-[(4-chlorophenyl)methyl]-4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]benzenesulfonamide (PubChem CID 20914244) has the molecular formula C21H16ClN3O4S and a molecular weight of 441.90 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]benzenesulfonamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20914244 |
| Molecular Formula | C21H16ClN3O4S |
| Molecular Weight | 441.90 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]benzenesulfonamide |
| SMILES | O=C1c2cccnc2C(=O)N1Cc1ccc(S(=O)(=O)NCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H16ClN3O4S/c22-16-7-3-14(4-8-16)12-24-30(28,29)17-9-5-15(6-10-17)13-25-20(26)18-2-1-11-23-19(18)21(25)27/h1-11,24H,12-13H2 |
| InChIKey | YTTHCDSOQLILJJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.90 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|