C19H21N3O4S — CID 110632884
2-[2-[4-(propan-2-ylsulfamoylamino)phenyl]ethyl]isoindole-1,3-dione (PubChem CID 110632884) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[2-[4-(propan-2-ylsulfamoylamino)phenyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(propan-2-ylsulfamoylamino)phenyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 110632884 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-[2-[4-(propan-2-ylsulfamoylamino)phenyl]ethyl]isoindole-1,3-dione |
| SMILES | CC(C)NS(=O)(=O)Nc1ccc(CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-13(2)20-27(25,26)21-15-9-7-14(8-10-15)11-12-22-18(23)16-5-3-4-6-17(16)19(22)24/h3-10,13,20-21H,11-12H2,1-2H3 |
| InChIKey | TXRDFCDHAYEJMW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|