C21H24N4O5 — CID 108738766
ethyl 5-[[2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoyl]amino]-1-methylpyrazole-4-carboxylate (PubChem CID 108738766) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is ethyl 5-[[2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoyl]amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoyl]amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108738766 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | ethyl 5-[[2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoyl]amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)C(C(C)CC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H24N4O5/c1-5-12(3)16(25-19(27)13-9-7-8-10-14(13)20(25)28)18(26)23-17-15(11-22-24(17)4)21(29)30-6-2/h7-12,16H,5-6H2,1-4H3,(H,23,26) |
| InChIKey | LAZJHNBPNTTWPY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|