C23H21N3O3 — CID 11846431
(2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-quinolin-8-ylpentanamide (PubChem CID 11846431) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-quinolin-8-ylpentanamide.
| Compound Name | (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-quinolin-8-ylpentanamide |
|---|---|
| PubChem CID | 11846431 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-quinolin-8-ylpentanamide |
| SMILES | CC[C@H](C)[C@@H](C(=O)Nc1cccc2cccnc12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H21N3O3/c1-3-14(2)20(26-22(28)16-10-4-5-11-17(16)23(26)29)21(27)25-18-12-6-8-15-9-7-13-24-19(15)18/h4-14,20H,3H2,1-2H3,(H,25,27)/t14-,20-/m0/s1 |
| InChIKey | CVABVYURORRDRZ-XOBRGWDASA-N |
| XLogP | 3.88 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|