C24H21N3O5 — CID 102253774
[(2S,3S)-2-(1,3-dioxoisoindol-2-yl)-1-oxo-1-(quinolin-8-ylamino)pentan-3-yl] acetate (PubChem CID 102253774) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is [(2S,3S)-2-(1,3-dioxoisoindol-2-yl)-1-oxo-1-(quinolin-8-ylamino)pentan-3-yl] acetate.
| Compound Name | [(2S,3S)-2-(1,3-dioxoisoindol-2-yl)-1-oxo-1-(quinolin-8-ylamino)pentan-3-yl] acetate |
|---|---|
| PubChem CID | 102253774 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [(2S,3S)-2-(1,3-dioxoisoindol-2-yl)-1-oxo-1-(quinolin-8-ylamino)pentan-3-yl] acetate |
| SMILES | CC[C@H](OC(C)=O)[C@@H](C(=O)Nc1cccc2cccnc12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H21N3O5/c1-3-19(32-14(2)28)21(27-23(30)16-10-4-5-11-17(16)24(27)31)22(29)26-18-12-6-8-15-9-7-13-25-20(15)18/h4-13,19,21H,3H2,1-2H3,(H,26,29)/t19-,21-/m0/s1 |
| InChIKey | HXZROCUACJANDS-FPOVZHCZSA-N |
| XLogP | 3.18 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|