C22H19N3O4S — CID 134160206
(2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfinyl-N-quinolin-8-ylbutanamide (PubChem CID 134160206) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfinyl-N-quinolin-8-ylbutanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfinyl-N-quinolin-8-ylbutanamide |
|---|---|
| PubChem CID | 134160206 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfinyl-N-quinolin-8-ylbutanamide |
| SMILES | CS(=O)CC[C@@H](C(=O)Nc1cccc2cccnc12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H19N3O4S/c1-30(29)13-11-18(25-21(27)15-8-2-3-9-16(15)22(25)28)20(26)24-17-10-4-6-14-7-5-12-23-19(14)17/h2-10,12,18H,11,13H2,1H3,(H,24,26)/t18-,30?/m0/s1 |
| InChIKey | XMWWMIQMCLKHQO-RZQQEOIVSA-N |
| XLogP | 2.61 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|