C27H31N3O4Si — CID 134160194
(2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-N-quinolin-8-ylbutanamide (PubChem CID 134160194) has the molecular formula C27H31N3O4Si and a molecular weight of 489.65 g/mol. Its IUPAC name is (2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-N-quinolin-8-ylbutanamide.
| Compound Name | (2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-N-quinolin-8-ylbutanamide |
|---|---|
| PubChem CID | 134160194 |
| Molecular Formula | C27H31N3O4Si |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | (2S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxoisoindol-2-yl)-N-quinolin-8-ylbutanamide |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](C(=O)Nc1cccc2cccnc12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H31N3O4Si/c1-27(2,3)35(4,5)34-17-15-22(30-25(32)19-12-6-7-13-20(19)26(30)33)24(31)29-21-14-8-10-18-11-9-16-28-23(18)21/h6-14,16,22H,15,17H2,1-5H3,(H,29,31)/t22-/m0/s1 |
| InChIKey | URXJNVXHAWCALG-QFIPXVFZSA-N |
| XLogP | 5.25 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|