C24H20N2O6S — CID 10939541
dimethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-quinolin-8-ylsulfanylpentanedioate (PubChem CID 10939541) has the molecular formula C24H20N2O6S and a molecular weight of 464.50 g/mol. Its IUPAC name is dimethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-quinolin-8-ylsulfanylpentanedioate.
| Compound Name | dimethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-quinolin-8-ylsulfanylpentanedioate |
|---|---|
| PubChem CID | 10939541 |
| Molecular Formula | C24H20N2O6S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | dimethyl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-quinolin-8-ylsulfanylpentanedioate |
| SMILES | COC(=O)C(C[C@@H](C(=O)OC)N1C(=O)c2ccccc2C1=O)Sc1cccc2cccnc12 |
| InChI | InChI=1S/C24H20N2O6S/c1-31-23(29)17(26-21(27)15-9-3-4-10-16(15)22(26)28)13-19(24(30)32-2)33-18-11-5-7-14-8-6-12-25-20(14)18/h3-12,17,19H,13H2,1-2H3/t17-,19?/m0/s1 |
| InChIKey | KBTOVYYWHPFIBV-KKFHFHRHSA-N |
| XLogP | 3.10 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|