C20H21N3S — CID 23732072
1-(2,6-diethylphenyl)-3-quinolin-8-ylthiourea (PubChem CID 23732072) has the molecular formula C20H21N3S and a molecular weight of 335.48 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-quinolin-8-ylthiourea.
| Compound Name | 1-(2,6-diethylphenyl)-3-quinolin-8-ylthiourea |
|---|---|
| PubChem CID | 23732072 |
| Molecular Formula | C20H21N3S |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-quinolin-8-ylthiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C20H21N3S/c1-3-14-8-5-9-15(4-2)18(14)23-20(24)22-17-12-6-10-16-11-7-13-21-19(16)17/h5-13H,3-4H2,1-2H3,(H2,22,23,24) |
| InChIKey | BALBEWMIZGYUKE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|