C21H22N4O3S2 — CID 78899574
N-(5-piperidin-1-yl-2-pyridinyl)-3-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 78899574) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is N-(5-piperidin-1-yl-2-pyridinyl)-3-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(5-piperidin-1-yl-2-pyridinyl)-3-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 78899574 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-(5-piperidin-1-yl-2-pyridinyl)-3-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cn1)c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H22N4O3S2/c26-21(23-19-10-9-18(15-22-19)25-11-2-1-3-12-25)16-6-4-7-17(14-16)24-30(27,28)20-8-5-13-29-20/h4-10,13-15,24H,1-3,11-12H2,(H,22,23,26) |
| InChIKey | HDGNNEVQBXLVKZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |