C23H25N3O3S2 — CID 60505090
N-(1-phenyl-2-pyrrolidin-1-ylethyl)-3-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 60505090) has the molecular formula C23H25N3O3S2 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-(1-phenyl-2-pyrrolidin-1-ylethyl)-3-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(1-phenyl-2-pyrrolidin-1-ylethyl)-3-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 60505090 |
| Molecular Formula | C23H25N3O3S2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-(1-phenyl-2-pyrrolidin-1-ylethyl)-3-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NC(CN1CCCC1)c1ccccc1)c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C23H25N3O3S2/c27-23(24-21(17-26-13-4-5-14-26)18-8-2-1-3-9-18)19-10-6-11-20(16-19)25-31(28,29)22-12-7-15-30-22/h1-3,6-12,15-16,21,25H,4-5,13-14,17H2,(H,24,27) |
| InChIKey | GBQZUTPVOWJORN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |