C9H10ClN3O2S2 — CID 112699494
5-chloro-N-(5-ethyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide (PubChem CID 112699494) has the molecular formula C9H10ClN3O2S2 and a molecular weight of 291.79 g/mol. Its IUPAC name is 5-chloro-N-(5-ethyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(5-ethyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 112699494 |
| Molecular Formula | C9H10ClN3O2S2 |
| Molecular Weight | 291.79 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 5-chloro-N-(5-ethyl-1H-pyrazol-3-yl)thiophene-2-sulfonamide |
| SMILES | CCc1cc(NS(=O)(=O)c2ccc(Cl)s2)n[nH]1 |
| InChI | InChI=1S/C9H10ClN3O2S2/c1-2-6-5-8(12-11-6)13-17(14,15)9-4-3-7(10)16-9/h3-5H,2H2,1H3,(H2,11,12,13) |
| InChIKey | ZKLJQJHCCADAKY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |