C12H12F3N3O2S — CID 115695455
N-(5-ethyl-1H-pyrazol-3-yl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 115695455) has the molecular formula C12H12F3N3O2S and a molecular weight of 319.31 g/mol. Its IUPAC name is N-(5-ethyl-1H-pyrazol-3-yl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(5-ethyl-1H-pyrazol-3-yl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115695455 |
| Molecular Formula | C12H12F3N3O2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | N-(5-ethyl-1H-pyrazol-3-yl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCc1cc(NS(=O)(=O)c2ccccc2C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C12H12F3N3O2S/c1-2-8-7-11(17-16-8)18-21(19,20)10-6-4-3-5-9(10)12(13,14)15/h3-7H,2H2,1H3,(H2,16,17,18) |
| InChIKey | CHQFSZHODNHODE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |