C19H26N4O2S — CID 113026011
4-ethyl-N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]benzenesulfonamide (PubChem CID 113026011) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 4-ethyl-N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113026011 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-ethyl-N-[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(N3CCN(CC)CC3)cn2)cc1 |
| InChI | InChI=1S/C19H26N4O2S/c1-3-16-5-8-18(9-6-16)26(24,25)21-19-10-7-17(15-20-19)23-13-11-22(4-2)12-14-23/h5-10,15H,3-4,11-14H2,1-2H3,(H,20,21) |
| InChIKey | LEEVCESEANJCLS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |